C11H13F10NO2 — CID 156806392
4-[3-ethoxy-1,1,2,2,4,4,4-heptafluoro-3-(trifluoromethyl)butyl]morpholine (PubChem CID 156806392) has the molecular formula C11H13F10NO2 and a molecular weight of 381.21 g/mol. Its IUPAC name is 4-[3-ethoxy-1,1,2,2,4,4,4-heptafluoro-3-(trifluoromethyl)butyl]morpholine.
| Compound Name | 4-[3-ethoxy-1,1,2,2,4,4,4-heptafluoro-3-(trifluoromethyl)butyl]morpholine |
|---|---|
| PubChem CID | 156806392 |
| Molecular Formula | C11H13F10NO2 |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 4-[3-ethoxy-1,1,2,2,4,4,4-heptafluoro-3-(trifluoromethyl)butyl]morpholine |
| SMILES | CCOC(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)N1CCOCC1 |
| InChI | InChI=1S/C11H13F10NO2/c1-2-24-7(9(14,15)16,10(17,18)19)8(12,13)11(20,21)22-3-5-23-6-4-22/h2-6H2,1H3 |
| InChIKey | BFPCIINHOFFMAZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|