C8H2F12O3S — CID 168509889
(4E,6E)-1,1,2,2,3,4,5,6,7,8,8,8-dodecafluoroocta-4,6-diene-1-sulfonic acid (PubChem CID 168509889) has the molecular formula C8H2F12O3S and a molecular weight of 406.14 g/mol. Its IUPAC name is (4E,6E)-1,1,2,2,3,4,5,6,7,8,8,8-dodecafluoroocta-4,6-diene-1-sulfonic acid.
| Compound Name | (4E,6E)-1,1,2,2,3,4,5,6,7,8,8,8-dodecafluoroocta-4,6-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 168509889 |
| Molecular Formula | C8H2F12O3S |
| Molecular Weight | 406.14 g/mol |
| Exact Mass | 405.95 |
| IUPAC Name | (4E,6E)-1,1,2,2,3,4,5,6,7,8,8,8-dodecafluoroocta-4,6-diene-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)/C(F)=C(F)/C(F)=C(\F)C(F)(F)F |
| InChI | InChI=1S/C8H2F12O3S/c9-1(3(11)5(13)7(16,17)18)2(10)4(12)6(14,15)8(19,20)24(21,22)23/h4H,(H,21,22,23)/b2-1+,5-3+ |
| InChIKey | LNGRXZMPSVBCIP-NRNIAZNESA-N |
| XLogP | 4.30 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.14 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|