C4H2F8O4S — CID 87285272
1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethanesulfonic acid (PubChem CID 87285272) has the molecular formula C4H2F8O4S and a molecular weight of 298.11 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 87285272 |
| Molecular Formula | C4H2F8O4S |
| Molecular Weight | 298.11 g/mol |
| Exact Mass | 297.95 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)OC(F)C(F)(F)F |
| InChI | InChI=1S/C4H2F8O4S/c5-1(2(6,7)8)16-3(9,10)4(11,12)17(13,14)15/h1H,(H,13,14,15) |
| InChIKey | JOYBOBIZKIJEDU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.11 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|