C4HBF10O7S2 — CID 175605694
bis(1,1,2,2,2-pentafluoroethylsulfonyloxy)borinic acid (PubChem CID 175605694) has the molecular formula C4HBF10O7S2 and a molecular weight of 425.97 g/mol. Its IUPAC name is bis(1,1,2,2,2-pentafluoroethylsulfonyloxy)borinic acid.
| Compound Name | bis(1,1,2,2,2-pentafluoroethylsulfonyloxy)borinic acid |
|---|---|
| PubChem CID | 175605694 |
| Molecular Formula | C4HBF10O7S2 |
| Molecular Weight | 425.97 g/mol |
| Exact Mass | 425.91 |
| IUPAC Name | bis(1,1,2,2,2-pentafluoroethylsulfonyloxy)borinic acid |
| SMILES | O=S(=O)(OB(O)OS(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4HBF10O7S2/c6-1(7,8)3(12,13)23(17,18)21-5(16)22-24(19,20)4(14,15)2(9,10)11/h16H |
| InChIKey | FQCCVOPENQSLGG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.97 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|