C17H15F24IO3S — CID 88736755
CID 88736755 (PubChem CID 88736755) has the molecular formula C17H15F24IO3S and a molecular weight of 882.23 g/mol.
| Compound Name | CID 88736755 |
|---|---|
| PubChem CID | 88736755 |
| Molecular Formula | C17H15F24IO3S |
| Molecular Weight | 882.23 g/mol |
| Exact Mass | 881.94 |
| IUPAC Name | — |
| SMILES | FC(CCCCCCCC(F)(F)F)C(F)(F)[I+](F)(F)(F)(F)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C16H15F21I.CHF3O3S/c17-8(6-4-2-1-3-5-7-9(18,19)20)10(21,22)38(34,35,36,37)16(33)14(29,30)12(25,26)11(23,24)13(27,28)15(16,31)32;2-1(3,4)8(5,6)7/h8H,1-7H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | HNARXDQEKQBZMV-UHFFFAOYSA-M |
| XLogP | 6.89 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.23 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|