C10H21F4NO3S — CID 141492118
dimethylazanium;1,8,8,8-tetrafluorooctane-1-sulfonate (PubChem CID 141492118) has the molecular formula C10H21F4NO3S and a molecular weight of 311.34 g/mol. Its IUPAC name is dimethylazanium;1,8,8,8-tetrafluorooctane-1-sulfonate.
| Compound Name | dimethylazanium;1,8,8,8-tetrafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 141492118 |
| Molecular Formula | C10H21F4NO3S |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | dimethylazanium;1,8,8,8-tetrafluorooctane-1-sulfonate |
| SMILES | C[NH2+]C.O=S(=O)([O-])C(F)CCCCCCC(F)(F)F |
| InChI | InChI=1S/C8H14F4O3S.C2H7N/c9-7(16(13,14)15)5-3-1-2-4-6-8(10,11)12;1-3-2/h7H,1-6H2,(H,13,14,15);3H,1-2H3 |
| InChIKey | QYYLEUOODGCWET-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|