C12H19F5O2 — CID 91054044
(3-fluoro-2-methylpropyl) 2-methylprop-2-enoate;1,1,1,4-tetrafluorobutane (PubChem CID 91054044) has the molecular formula C12H19F5O2 and a molecular weight of 290.27 g/mol. Its IUPAC name is (3-fluoro-2-methylpropyl) 2-methylprop-2-enoate;1,1,1,4-tetrafluorobutane.
| Compound Name | (3-fluoro-2-methylpropyl) 2-methylprop-2-enoate;1,1,1,4-tetrafluorobutane |
|---|---|
| PubChem CID | 91054044 |
| Molecular Formula | C12H19F5O2 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (3-fluoro-2-methylpropyl) 2-methylprop-2-enoate;1,1,1,4-tetrafluorobutane |
| SMILES | C=C(C)C(=O)OCC(C)CF.FCCCC(F)(F)F |
| InChI | InChI=1S/C8H13FO2.C4H6F4/c1-6(2)8(10)11-5-7(3)4-9;5-3-1-2-4(6,7)8/h7H,1,4-5H2,2-3H3;1-3H2 |
| InChIKey | KEMFSTMYJAZUAN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|