C20H25F15O6Si — CID 101169771
[4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-8-(trifluoromethyl)-2-(3-trimethoxysilylpropoxy)nonyl] 2-methylprop-2-enoate (PubChem CID 101169771) has the molecular formula C20H25F15O6Si and a molecular weight of 674.47 g/mol. Its IUPAC name is [4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-8-(trifluoromethyl)-2-(3-trimethoxysilylpropoxy)nonyl] 2-methylprop-2-enoate.
| Compound Name | [4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-8-(trifluoromethyl)-2-(3-trimethoxysilylpropoxy)nonyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 101169771 |
| Molecular Formula | C20H25F15O6Si |
| Molecular Weight | 674.47 g/mol |
| Exact Mass | 674.12 |
| IUPAC Name | [4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-8-(trifluoromethyl)-2-(3-trimethoxysilylpropoxy)nonyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)OCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C20H25F15O6Si/c1-11(2)13(36)41-10-12(40-7-6-8-42(37-3,38-4)39-5)9-14(21,22)16(24,25)18(28,29)17(26,27)15(23,19(30,31)32)20(33,34)35/h12H,1,6-10H2,2-5H3 |
| InChIKey | TZGGZTYMSOVHLJ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.47 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|