C34H70NaO12S2 — CID 6331016
CID 6331016 (PubChem CID 6331016) has the molecular formula C34H70NaO12S2 and a molecular weight of 758.05 g/mol.
| Compound Name | CID 6331016 |
|---|---|
| PubChem CID | 6331016 |
| Molecular Formula | C34H70NaO12S2 |
| Molecular Weight | 758.05 g/mol |
| Exact Mass | 757.42 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCCOCC(COCCOCC(COCCCCCCCCCC)OCCCS(=O)(=O)O)OCCCS(=O)(=O)O.[Na] |
| InChI | InChI=1S/C34H70O12S2.Na/c1-3-5-7-9-11-13-15-17-21-41-29-33(45-23-19-27-47(35,36)37)31-43-25-26-44-32-34(46-24-20-28-48(38,39)40)30-42-22-18-16-14-12-10-8-6-4-2;/h33-34H,3-32H2,1-2H3,(H,35,36,37)(H,38,39,40); |
| InChIKey | KXZPUWQMMLOTRJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.05 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|