C19H25F4NO7S — CID 58445742
[4-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)oxysulfonyl]-3,3,4,4-tetrafluorobutyl] cyclohexanecarboxylate (PubChem CID 58445742) has the molecular formula C19H25F4NO7S and a molecular weight of 487.47 g/mol. Its IUPAC name is [4-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)oxysulfonyl]-3,3,4,4-tetrafluorobutyl] cyclohexanecarboxylate.
| Compound Name | [4-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)oxysulfonyl]-3,3,4,4-tetrafluorobutyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 58445742 |
| Molecular Formula | C19H25F4NO7S |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | [4-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)oxysulfonyl]-3,3,4,4-tetrafluorobutyl] cyclohexanecarboxylate |
| SMILES | O=C(OCCC(F)(F)C(F)(F)S(=O)(=O)ON1C(=O)C2CCCCC2C1=O)C1CCCCC1 |
| InChI | InChI=1S/C19H25F4NO7S/c20-18(21,10-11-30-17(27)12-6-2-1-3-7-12)19(22,23)32(28,29)31-24-15(25)13-8-4-5-9-14(13)16(24)26/h12-14H,1-11H2 |
| InChIKey | FPERDBCDWJPFIR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|