C16H23F3O7S — CID 123464143
4-[(E)-1-(cyclohexanecarbonyloxy)-1-fluoro-2-oxopent-3-enoxy]-1,1-difluorobutane-1-sulfonic acid (PubChem CID 123464143) has the molecular formula C16H23F3O7S and a molecular weight of 416.41 g/mol. Its IUPAC name is 4-[(E)-1-(cyclohexanecarbonyloxy)-1-fluoro-2-oxopent-3-enoxy]-1,1-difluorobutane-1-sulfonic acid.
| Compound Name | 4-[(E)-1-(cyclohexanecarbonyloxy)-1-fluoro-2-oxopent-3-enoxy]-1,1-difluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 123464143 |
| Molecular Formula | C16H23F3O7S |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 4-[(E)-1-(cyclohexanecarbonyloxy)-1-fluoro-2-oxopent-3-enoxy]-1,1-difluorobutane-1-sulfonic acid |
| SMILES | C/C=C/C(=O)C(F)(OCCCC(F)(F)S(=O)(=O)O)OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C16H23F3O7S/c1-2-7-13(20)16(19,26-14(21)12-8-4-3-5-9-12)25-11-6-10-15(17,18)27(22,23)24/h2,7,12H,3-6,8-11H2,1H3,(H,22,23,24)/b7-2+ |
| InChIKey | HYWJLOLRSSKHPS-FARCUNLSSA-N |
| XLogP | 3.16 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|