C15H21F5O5 — CID 118261279
[2-(3,3-difluorobutoxy)-1,1,1-trifluoro-3-methoxy-3-oxopropan-2-yl] cyclohexanecarboxylate (PubChem CID 118261279) has the molecular formula C15H21F5O5 and a molecular weight of 376.32 g/mol. Its IUPAC name is [2-(3,3-difluorobutoxy)-1,1,1-trifluoro-3-methoxy-3-oxopropan-2-yl] cyclohexanecarboxylate.
| Compound Name | [2-(3,3-difluorobutoxy)-1,1,1-trifluoro-3-methoxy-3-oxopropan-2-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 118261279 |
| Molecular Formula | C15H21F5O5 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | [2-(3,3-difluorobutoxy)-1,1,1-trifluoro-3-methoxy-3-oxopropan-2-yl] cyclohexanecarboxylate |
| SMILES | COC(=O)C(OCCC(C)(F)F)(OC(=O)C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C15H21F5O5/c1-13(16,17)8-9-24-14(12(22)23-2,15(18,19)20)25-11(21)10-6-4-3-5-7-10/h10H,3-9H2,1-2H3 |
| InChIKey | ZSPHJHBMIFHYJT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|