C7H11F2NaO4S — CID 59185156
sodium 1,1-difluoro-2-pentanoyloxyethanesulfinate (PubChem CID 59185156) has the molecular formula C7H11F2NaO4S and a molecular weight of 252.21 g/mol. Its IUPAC name is sodium 1,1-difluoro-2-pentanoyloxyethanesulfinate.
| Compound Name | sodium 1,1-difluoro-2-pentanoyloxyethanesulfinate |
|---|---|
| PubChem CID | 59185156 |
| Molecular Formula | C7H11F2NaO4S |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | sodium 1,1-difluoro-2-pentanoyloxyethanesulfinate |
| SMILES | CCCCC(=O)OCC(F)(F)S(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H12F2O4S.Na/c1-2-3-4-6(10)13-5-7(8,9)14(11)12;/h2-5H2,1H3,(H,11,12);/q;+1/p-1 |
| InChIKey | QNOXHQNFKJLRED-UHFFFAOYSA-M |
| XLogP | -1.80 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|