C15H19NO5S2 — CID 71890926
N-(3-methylsulfonylphenyl)sulfonylbicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 71890926) has the molecular formula C15H19NO5S2 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-(3-methylsulfonylphenyl)sulfonylbicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | N-(3-methylsulfonylphenyl)sulfonylbicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 71890926 |
| Molecular Formula | C15H19NO5S2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | N-(3-methylsulfonylphenyl)sulfonylbicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(S(=O)(=O)NC(=O)C2CC3CCC2C3)c1 |
| InChI | InChI=1S/C15H19NO5S2/c1-22(18,19)12-3-2-4-13(9-12)23(20,21)16-15(17)14-8-10-5-6-11(14)7-10/h2-4,9-11,14H,5-8H2,1H3,(H,16,17) |
| InChIKey | OJZUPDRDUYKPMB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |