C19H21F9O2 — CID 87940504
[3-(1-adamantyl)-1,1,1,5,5,5-hexafluoropentan-3-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 87940504) has the molecular formula C19H21F9O2 and a molecular weight of 452.36 g/mol. Its IUPAC name is [3-(1-adamantyl)-1,1,1,5,5,5-hexafluoropentan-3-yl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [3-(1-adamantyl)-1,1,1,5,5,5-hexafluoropentan-3-yl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 87940504 |
| Molecular Formula | C19H21F9O2 |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | [3-(1-adamantyl)-1,1,1,5,5,5-hexafluoropentan-3-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(CC(F)(F)F)(CC(F)(F)F)C12CC3CC(CC(C3)C1)C2)C(F)(F)F |
| InChI | InChI=1S/C19H21F9O2/c1-10(19(26,27)28)14(29)30-16(8-17(20,21)22,9-18(23,24)25)15-5-11-2-12(6-15)4-13(3-11)7-15/h11-13H,1-9H2 |
| InChIKey | ZSWFSIWNECDQTE-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|