C22H33F9O3 — CID 91283405
[2-(2-bicyclo[2.2.1]heptanyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] tert-butyl carbonate;3-methyl-3-(trifluoromethyl)pentane (PubChem CID 91283405) has the molecular formula C22H33F9O3 and a molecular weight of 516.49 g/mol. Its IUPAC name is [2-(2-bicyclo[2.2.1]heptanyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] tert-butyl carbonate;3-methyl-3-(trifluoromethyl)pentane.
| Compound Name | [2-(2-bicyclo[2.2.1]heptanyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] tert-butyl carbonate;3-methyl-3-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 91283405 |
| Molecular Formula | C22H33F9O3 |
| Molecular Weight | 516.49 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | [2-(2-bicyclo[2.2.1]heptanyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] tert-butyl carbonate;3-methyl-3-(trifluoromethyl)pentane |
| SMILES | CC(C)(C)OC(=O)OC(C1CC2CCC1C2)(C(F)(F)F)C(F)(F)F.CCC(C)(CC)C(F)(F)F |
| InChI | InChI=1S/C15H20F6O3.C7H13F3/c1-12(2,3)23-11(22)24-13(14(16,17)18,15(19,20)21)10-7-8-4-5-9(10)6-8;1-4-6(3,5-2)7(8,9)10/h8-10H,4-7H2,1-3H3;4-5H2,1-3H3 |
| InChIKey | SAGMUELGKNDURM-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.49 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |