C17H26O2 — CID 144690452
8-tricyclo[5.2.1.02,6]decanyl 2-ethyl-2-methylbut-3-enoate (PubChem CID 144690452) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 8-tricyclo[5.2.1.02,6]decanyl 2-ethyl-2-methylbut-3-enoate.
| Compound Name | 8-tricyclo[5.2.1.02,6]decanyl 2-ethyl-2-methylbut-3-enoate |
|---|---|
| PubChem CID | 144690452 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 8-tricyclo[5.2.1.02,6]decanyl 2-ethyl-2-methylbut-3-enoate |
| SMILES | C=CC(C)(CC)C(=O)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C17H26O2/c1-4-17(3,5-2)16(18)19-15-10-11-9-14(15)13-8-6-7-12(11)13/h4,11-15H,1,5-10H2,2-3H3 |
| InChIKey | ULUJMUPOQKYJCE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|