C18H30O — CID 123684704
8-(3,4,4-trimethylpent-1-en-2-yloxy)tricyclo[5.2.1.02,6]decane (PubChem CID 123684704) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is 8-(3,4,4-trimethylpent-1-en-2-yloxy)tricyclo[5.2.1.02,6]decane.
| Compound Name | 8-(3,4,4-trimethylpent-1-en-2-yloxy)tricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 123684704 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 8-(3,4,4-trimethylpent-1-en-2-yloxy)tricyclo[5.2.1.02,6]decane |
| SMILES | C=C(OC1CC2CC1C1CCCC21)C(C)C(C)(C)C |
| InChI | InChI=1S/C18H30O/c1-11(18(3,4)5)12(2)19-17-10-13-9-16(17)15-8-6-7-14(13)15/h11,13-17H,2,6-10H2,1,3-5H3 |
| InChIKey | CSYJZBQPBWLUGP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|