C14H20O — CID 20676852
8-buta-1,3-dien-2-yloxytricyclo[5.2.1.02,6]decane (PubChem CID 20676852) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 8-buta-1,3-dien-2-yloxytricyclo[5.2.1.02,6]decane.
| Compound Name | 8-buta-1,3-dien-2-yloxytricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 20676852 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 8-buta-1,3-dien-2-yloxytricyclo[5.2.1.02,6]decane |
| SMILES | C=CC(=C)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C14H20O/c1-3-9(2)15-14-8-10-7-13(14)12-6-4-5-11(10)12/h3,10-14H,1-2,4-8H2 |
| InChIKey | NCKFREHXLPOBOY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|