C13H12F8O — CID 21057445
2,3,3,4,4,5,5,6-octafluoro-8-prop-2-enoxytricyclo[5.2.1.02,6]decane (PubChem CID 21057445) has the molecular formula C13H12F8O and a molecular weight of 336.22 g/mol. Its IUPAC name is 2,3,3,4,4,5,5,6-octafluoro-8-prop-2-enoxytricyclo[5.2.1.02,6]decane.
| Compound Name | 2,3,3,4,4,5,5,6-octafluoro-8-prop-2-enoxytricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 21057445 |
| Molecular Formula | C13H12F8O |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2,3,3,4,4,5,5,6-octafluoro-8-prop-2-enoxytricyclo[5.2.1.02,6]decane |
| SMILES | C=CCOC1CC2CC1C1(F)C(F)(F)C(F)(F)C(F)(F)C21F |
| InChI | InChI=1S/C13H12F8O/c1-2-3-22-8-5-6-4-7(8)10(15)9(6,14)11(16,17)13(20,21)12(10,18)19/h2,6-8H,1,3-5H2 |
| InChIKey | NWIHZROGRYZLDE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|