C22H40O2 — CID 123861647
2-tert-butyl-2,4,4-trimethyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)pentan-1-ol (PubChem CID 123861647) has the molecular formula C22H40O2 and a molecular weight of 336.56 g/mol. Its IUPAC name is 2-tert-butyl-2,4,4-trimethyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)pentan-1-ol.
| Compound Name | 2-tert-butyl-2,4,4-trimethyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)pentan-1-ol |
|---|---|
| PubChem CID | 123861647 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | 2-tert-butyl-2,4,4-trimethyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)pentan-1-ol |
| SMILES | CC(C)(C)CC(C)(C(O)OC1CC2CC1C1CCCC21)C(C)(C)C |
| InChI | InChI=1S/C22H40O2/c1-20(2,3)13-22(7,21(4,5)6)19(23)24-18-12-14-11-17(18)16-10-8-9-15(14)16/h14-19,23H,8-13H2,1-7H3 |
| InChIKey | JCGIEGOTHNPWHJ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|