C11H18O3 — CID 101145918
2-methylprop-2-enoyl 2,2,3-trimethylbutanoate (PubChem CID 101145918) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 2-methylprop-2-enoyl 2,2,3-trimethylbutanoate.
| Compound Name | 2-methylprop-2-enoyl 2,2,3-trimethylbutanoate |
|---|---|
| PubChem CID | 101145918 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 2-methylprop-2-enoyl 2,2,3-trimethylbutanoate |
| SMILES | C=C(C)C(=O)OC(=O)C(C)(C)C(C)C |
| InChI | InChI=1S/C11H18O3/c1-7(2)9(12)14-10(13)11(5,6)8(3)4/h8H,1H2,2-6H3 |
| InChIKey | KMFRREXPCRAFOU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|