C15H22O9 — CID 161234061
2,2-dihydroxypropanoyl 2-methylprop-2-enoate;bis(2-methylprop-2-enoic acid) (PubChem CID 161234061) has the molecular formula C15H22O9 and a molecular weight of 346.33 g/mol. Its IUPAC name is 2,2-dihydroxypropanoyl 2-methylprop-2-enoate;bis(2-methylprop-2-enoic acid).
| Compound Name | 2,2-dihydroxypropanoyl 2-methylprop-2-enoate;bis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 161234061 |
| Molecular Formula | C15H22O9 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2,2-dihydroxypropanoyl 2-methylprop-2-enoate;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.C=C(C)C(=O)OC(=O)C(C)(O)O |
| InChI | InChI=1S/C7H10O5.2C4H6O2/c1-4(2)5(8)12-6(9)7(3,10)11;2*1-3(2)4(5)6/h10-11H,1H2,2-3H3;2*1H2,2H3,(H,5,6) |
| InChIKey | UZDDCCSESGZNBB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|