About bis(2-methylprop-2-enoic acid);2-methylprop-2-enoylperoxycarbonyl 2-methylprop-2-enoate
bis(2-methylprop-2-enoic acid);2-methylprop-2-enoylperoxycarbonyl 2-methylprop-2-enoate (PubChem CID 87087130) has the molecular formula C17H22O10
and a molecular weight of 386.35 g/mol. Its IUPAC name is bis(2-methylprop-2-enoic acid);2-methylprop-2-enoylperoxycarbonyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | bis(2-methylprop-2-enoic acid);2-methylprop-2-enoylperoxycarbonyl 2-methylprop-2-enoate |
| PubChem CID | 87087130 |
| Molecular Formula | C17H22O10 |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | bis(2-methylprop-2-enoic acid);2-methylprop-2-enoylperoxycarbonyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.C=C(C)C(=O)OOC(=O)OC(=O)C(=C)C |
| InChI | InChI=1S/C9H10O6.2C4H6O2/c1-5(2)7(10)13-9(12)15-14-8(11)6(3)4;2*1-3(2)4(5)6/h1,3H2,2,4H3;2*1H2,2H3,(H,5,6) |
| InChIKey | VYOBQWPXDXCEKZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylprop-2-enoic acid);2-methylprop-2-enoylperoxycarbonyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylprop-2-enoic acid);2-methylprop-2-enoylperoxycarbonyl 2-methylprop-2-enoate?
The IUPAC name of bis(2-methylprop-2-enoic acid);2-methylprop-2-enoylperoxycarbonyl 2-methylprop-2-enoate (CID 87087130) is bis(2-methylprop-2-enoic acid);2-methylprop-2-enoylperoxycarbonyl 2-methylprop-2-enoate.
What is the SMILES notation for bis(2-methylprop-2-enoic acid);2-methylprop-2-enoylperoxycarbonyl 2-methylprop-2-enoate?
The canonical SMILES for bis(2-methylprop-2-enoic acid);2-methylprop-2-enoylperoxycarbonyl 2-methylprop-2-enoate is C=C(C)C(=O)O.C=C(C)C(=O)O.C=C(C)C(=O)OOC(=O)OC(=O)C(=C)C.
What is the InChIKey of bis(2-methylprop-2-enoic acid);2-methylprop-2-enoylperoxycarbonyl 2-methylprop-2-enoate?
The InChIKey is VYOBQWPXDXCEKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O6.2C4H6O2/c1-5(2)7(10)13-9(12)15-14-8(11)6(3)4;2*1-3(2)4(5)6/h1,3H2,2,4H3;2*1H2,2H3,(H,5,6).
What are the key properties of bis(2-methylprop-2-enoic acid);2-methylprop-2-enoylperoxycarbonyl 2-methylprop-2-enoate?
bis(2-methylprop-2-enoic acid);2-methylprop-2-enoylperoxycarbonyl 2-methylprop-2-enoate has a molecular weight of 386.35 g/mol, XLogP of 2.57, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylprop-2-enoic acid);2-methylprop-2-enoylperoxycarbonyl 2-methylprop-2-enoate is sourced from PubChem (CID 87087130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).