C10H19BiO5 — CID 174895464
2-bismuthanyl-2,3-dimethylbutanoic acid;2-methylprop-2-eneperoxoic acid (PubChem CID 174895464) has the molecular formula C10H19BiO5 and a molecular weight of 428.24 g/mol. Its IUPAC name is 2-bismuthanyl-2,3-dimethylbutanoic acid;2-methylprop-2-eneperoxoic acid.
| Compound Name | 2-bismuthanyl-2,3-dimethylbutanoic acid;2-methylprop-2-eneperoxoic acid |
|---|---|
| PubChem CID | 174895464 |
| Molecular Formula | C10H19BiO5 |
| Molecular Weight | 428.24 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 2-bismuthanyl-2,3-dimethylbutanoic acid;2-methylprop-2-eneperoxoic acid |
| SMILES | C=C(C)C(=O)OO.CC(C)C(C)([BiH2])C(=O)O |
| InChI | InChI=1S/C6H11O2.C4H6O3.Bi.2H/c1-4(2)5(3)6(7)8;1-3(2)4(5)7-6;;;/h4H,1-3H3,(H,7,8);6H,1H2,2H3;;; |
| InChIKey | HGEFANCEWBHJGY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|