C15H23NO9S — CID 122613105
3-aminooxysulfonylpropyl 3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propanoate (PubChem CID 122613105) has the molecular formula C15H23NO9S and a molecular weight of 393.41 g/mol. Its IUPAC name is 3-aminooxysulfonylpropyl 3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propanoate.
| Compound Name | 3-aminooxysulfonylpropyl 3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propanoate |
|---|---|
| PubChem CID | 122613105 |
| Molecular Formula | C15H23NO9S |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 3-aminooxysulfonylpropyl 3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propanoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)C)C(=O)OCCCS(=O)(=O)ON |
| InChI | InChI=1S/C15H23NO9S/c1-10(2)13(17)23-8-12(9-24-14(18)11(3)4)15(19)22-6-5-7-26(20,21)25-16/h12H,1,3,5-9,16H2,2,4H3 |
| InChIKey | SCWLSIGUYTZFCP-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 148.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|