C16H24O9S — CID 118002454
4-[3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propanoyl]oxybutane-2-sulfonic acid (PubChem CID 118002454) has the molecular formula C16H24O9S and a molecular weight of 392.43 g/mol. Its IUPAC name is 4-[3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propanoyl]oxybutane-2-sulfonic acid.
| Compound Name | 4-[3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propanoyl]oxybutane-2-sulfonic acid |
|---|---|
| PubChem CID | 118002454 |
| Molecular Formula | C16H24O9S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 4-[3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propanoyl]oxybutane-2-sulfonic acid |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)C)C(=O)OCCC(C)S(=O)(=O)O |
| InChI | InChI=1S/C16H24O9S/c1-10(2)14(17)24-8-13(9-25-15(18)11(3)4)16(19)23-7-6-12(5)26(20,21)22/h12-13H,1,3,6-9H2,2,4-5H3,(H,20,21,22) |
| InChIKey | MCAOGYSTDMVYPQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|