C10H18O6S — CID 174585687
2-hydroxy-6-(2-methylprop-2-enoyloxy)hexane-3-sulfonic acid (PubChem CID 174585687) has the molecular formula C10H18O6S and a molecular weight of 266.31 g/mol. Its IUPAC name is 2-hydroxy-6-(2-methylprop-2-enoyloxy)hexane-3-sulfonic acid.
| Compound Name | 2-hydroxy-6-(2-methylprop-2-enoyloxy)hexane-3-sulfonic acid |
|---|---|
| PubChem CID | 174585687 |
| Molecular Formula | C10H18O6S |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2-hydroxy-6-(2-methylprop-2-enoyloxy)hexane-3-sulfonic acid |
| SMILES | C=C(C)C(=O)OCCCC(C(C)O)S(=O)(=O)O |
| InChI | InChI=1S/C10H18O6S/c1-7(2)10(12)16-6-4-5-9(8(3)11)17(13,14)15/h8-9,11H,1,4-6H2,2-3H3,(H,13,14,15) |
| InChIKey | OQVTZVMAQNRCOC-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|