C20H33NO9S — CID 122613278
2-aminooxysulfonylethyl 2,2-bis(2-methylprop-2-enoyloxymethyl)octanoate (PubChem CID 122613278) has the molecular formula C20H33NO9S and a molecular weight of 463.55 g/mol. Its IUPAC name is 2-aminooxysulfonylethyl 2,2-bis(2-methylprop-2-enoyloxymethyl)octanoate.
| Compound Name | 2-aminooxysulfonylethyl 2,2-bis(2-methylprop-2-enoyloxymethyl)octanoate |
|---|---|
| PubChem CID | 122613278 |
| Molecular Formula | C20H33NO9S |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 2-aminooxysulfonylethyl 2,2-bis(2-methylprop-2-enoyloxymethyl)octanoate |
| SMILES | C=C(C)C(=O)OCC(CCCCCC)(COC(=O)C(=C)C)C(=O)OCCS(=O)(=O)ON |
| InChI | InChI=1S/C20H33NO9S/c1-6-7-8-9-10-20(13-28-17(22)15(2)3,14-29-18(23)16(4)5)19(24)27-11-12-31(25,26)30-21/h2,4,6-14,21H2,1,3,5H3 |
| InChIKey | NZTUFOQMDIPZDX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 148.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|