C19H30O9S — CID 122611348
2,2-bis(2-methylprop-2-enoyloxymethyl)octanoyloxymethanesulfonic acid (PubChem CID 122611348) has the molecular formula C19H30O9S and a molecular weight of 434.51 g/mol. Its IUPAC name is 2,2-bis(2-methylprop-2-enoyloxymethyl)octanoyloxymethanesulfonic acid.
| Compound Name | 2,2-bis(2-methylprop-2-enoyloxymethyl)octanoyloxymethanesulfonic acid |
|---|---|
| PubChem CID | 122611348 |
| Molecular Formula | C19H30O9S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2,2-bis(2-methylprop-2-enoyloxymethyl)octanoyloxymethanesulfonic acid |
| SMILES | C=C(C)C(=O)OCC(CCCCCC)(COC(=O)C(=C)C)C(=O)OCS(=O)(=O)O |
| InChI | InChI=1S/C19H30O9S/c1-6-7-8-9-10-19(11-26-16(20)14(2)3,12-27-17(21)15(4)5)18(22)28-13-29(23,24)25/h2,4,6-13H2,1,3,5H3,(H,23,24,25) |
| InChIKey | KPDWHRKEGXAYOD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|