C26H44O9S — CID 122612334
10-[2,2-bis(2-methylprop-2-enoyloxymethyl)hexanoyloxy]decane-1-sulfonic acid (PubChem CID 122612334) has the molecular formula C26H44O9S and a molecular weight of 532.70 g/mol. Its IUPAC name is 10-[2,2-bis(2-methylprop-2-enoyloxymethyl)hexanoyloxy]decane-1-sulfonic acid.
| Compound Name | 10-[2,2-bis(2-methylprop-2-enoyloxymethyl)hexanoyloxy]decane-1-sulfonic acid |
|---|---|
| PubChem CID | 122612334 |
| Molecular Formula | C26H44O9S |
| Molecular Weight | 532.70 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | 10-[2,2-bis(2-methylprop-2-enoyloxymethyl)hexanoyloxy]decane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OCC(CCCC)(COC(=O)C(=C)C)C(=O)OCCCCCCCCCCS(=O)(=O)O |
| InChI | InChI=1S/C26H44O9S/c1-6-7-16-26(19-34-23(27)21(2)3,20-35-24(28)22(4)5)25(29)33-17-14-12-10-8-9-11-13-15-18-36(30,31)32/h2,4,6-20H2,1,3,5H3,(H,30,31,32) |
| InChIKey | KVLJQCQWQNZTEF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.70 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|