C22H20O5S — CID 170020808
3-(4-methoxy-7-prop-2-enoyloxydibenzothiophen-3-yl)propyl prop-2-enoate (PubChem CID 170020808) has the molecular formula C22H20O5S and a molecular weight of 396.46 g/mol. Its IUPAC name is 3-(4-methoxy-7-prop-2-enoyloxydibenzothiophen-3-yl)propyl prop-2-enoate.
| Compound Name | 3-(4-methoxy-7-prop-2-enoyloxydibenzothiophen-3-yl)propyl prop-2-enoate |
|---|---|
| PubChem CID | 170020808 |
| Molecular Formula | C22H20O5S |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 3-(4-methoxy-7-prop-2-enoyloxydibenzothiophen-3-yl)propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCc1ccc2c(sc3cc(OC(=O)C=C)ccc32)c1OC |
| InChI | InChI=1S/C22H20O5S/c1-4-19(23)26-12-6-7-14-8-10-17-16-11-9-15(27-20(24)5-2)13-18(16)28-22(17)21(14)25-3/h4-5,8-11,13H,1-2,6-7,12H2,3H3 |
| InChIKey | KESXNIJAUIAXOK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|