C23H16F6O7 — CID 170034369
3-[7-prop-2-enoyloxy-4,6-bis(trifluoromethoxy)dibenzofuran-3-yl]propyl prop-2-enoate (PubChem CID 170034369) has the molecular formula C23H16F6O7 and a molecular weight of 518.36 g/mol. Its IUPAC name is 3-[7-prop-2-enoyloxy-4,6-bis(trifluoromethoxy)dibenzofuran-3-yl]propyl prop-2-enoate.
| Compound Name | 3-[7-prop-2-enoyloxy-4,6-bis(trifluoromethoxy)dibenzofuran-3-yl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 170034369 |
| Molecular Formula | C23H16F6O7 |
| Molecular Weight | 518.36 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | 3-[7-prop-2-enoyloxy-4,6-bis(trifluoromethoxy)dibenzofuran-3-yl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCc1ccc2c(oc3c(OC(F)(F)F)c(OC(=O)C=C)ccc32)c1OC(F)(F)F |
| InChI | InChI=1S/C23H16F6O7/c1-3-16(30)32-11-5-6-12-7-8-13-14-9-10-15(33-17(31)4-2)21(36-23(27,28)29)20(14)34-19(13)18(12)35-22(24,25)26/h3-4,7-10H,1-2,5-6,11H2 |
| InChIKey | MRKWHOJJDSGSEG-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.36 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|