C31H28F6O8 — CID 90870530
[4-[[4-[(4-methoxyphenyl)methoxy]-2,3-bis(trifluoromethyl)phenoxy]methyl]phenoxy]methyl prop-2-enoate;methyl prop-2-enoate (PubChem CID 90870530) has the molecular formula C31H28F6O8 and a molecular weight of 642.54 g/mol. Its IUPAC name is [4-[[4-[(4-methoxyphenyl)methoxy]-2,3-bis(trifluoromethyl)phenoxy]methyl]phenoxy]methyl prop-2-enoate;methyl prop-2-enoate.
| Compound Name | [4-[[4-[(4-methoxyphenyl)methoxy]-2,3-bis(trifluoromethyl)phenoxy]methyl]phenoxy]methyl prop-2-enoate;methyl prop-2-enoate |
|---|---|
| PubChem CID | 90870530 |
| Molecular Formula | C31H28F6O8 |
| Molecular Weight | 642.54 g/mol |
| Exact Mass | 642.17 |
| IUPAC Name | [4-[[4-[(4-methoxyphenyl)methoxy]-2,3-bis(trifluoromethyl)phenoxy]methyl]phenoxy]methyl prop-2-enoate;methyl prop-2-enoate |
| SMILES | C=CC(=O)OC.C=CC(=O)OCOc1ccc(COc2ccc(OCc3ccc(OC)cc3)c(C(F)(F)F)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H22F6O6.C4H6O2/c1-3-23(34)39-16-38-20-10-6-18(7-11-20)15-37-22-13-12-21(24(26(28,29)30)25(22)27(31,32)33)36-14-17-4-8-19(35-2)9-5-17;1-3-4(5)6-2/h3-13H,1,14-16H2,2H3;3H,1H2,2H3 |
| InChIKey | KUFVHAIPRCHHLL-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.54 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|