C31H26F8O8 — CID 90962691
[2-fluoro-4-[[4-[(3-fluoro-4-methoxyphenyl)methoxy]-2,3-bis(trifluoromethyl)phenoxy]methyl]phenoxy]methyl prop-2-enoate;methyl prop-2-enoate (PubChem CID 90962691) has the molecular formula C31H26F8O8 and a molecular weight of 678.52 g/mol. Its IUPAC name is [2-fluoro-4-[[4-[(3-fluoro-4-methoxyphenyl)methoxy]-2,3-bis(trifluoromethyl)phenoxy]methyl]phenoxy]methyl prop-2-enoate;methyl prop-2-enoate.
| Compound Name | [2-fluoro-4-[[4-[(3-fluoro-4-methoxyphenyl)methoxy]-2,3-bis(trifluoromethyl)phenoxy]methyl]phenoxy]methyl prop-2-enoate;methyl prop-2-enoate |
|---|---|
| PubChem CID | 90962691 |
| Molecular Formula | C31H26F8O8 |
| Molecular Weight | 678.52 g/mol |
| Exact Mass | 678.15 |
| IUPAC Name | [2-fluoro-4-[[4-[(3-fluoro-4-methoxyphenyl)methoxy]-2,3-bis(trifluoromethyl)phenoxy]methyl]phenoxy]methyl prop-2-enoate;methyl prop-2-enoate |
| SMILES | C=CC(=O)OC.C=CC(=O)OCOc1ccc(COc2ccc(OCc3ccc(OC)c(F)c3)c(C(F)(F)F)c2C(F)(F)F)cc1F |
| InChI | InChI=1S/C27H20F8O6.C4H6O2/c1-3-23(36)41-14-40-20-7-5-16(11-18(20)29)13-39-22-9-8-21(24(26(30,31)32)25(22)27(33,34)35)38-12-15-4-6-19(37-2)17(28)10-15;1-3-4(5)6-2/h3-11H,1,12-14H2,2H3;3H,1H2,2H3 |
| InChIKey | XUWUCHZDGBSLCX-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.52 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|