C27H53N3O15P2 — CID 90891439
[2-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoylamino]-3-phosphonopropyl]phosphonic acid;2-[2-(2-methylprop-2-enylperoxy)ethylcarbamoyloxy]ethyl 2,2-dimethylbutanoate (PubChem CID 90891439) has the molecular formula C27H53N3O15P2 and a molecular weight of 721.67 g/mol. Its IUPAC name is [2-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoylamino]-3-phosphonopropyl]phosphonic acid;2-[2-(2-methylprop-2-enylperoxy)ethylcarbamoyloxy]ethyl 2,2-dimethylbutanoate.
| Compound Name | [2-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoylamino]-3-phosphonopropyl]phosphonic acid;2-[2-(2-methylprop-2-enylperoxy)ethylcarbamoyloxy]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90891439 |
| Molecular Formula | C27H53N3O15P2 |
| Molecular Weight | 721.67 g/mol |
| Exact Mass | 721.30 |
| IUPAC Name | [2-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoylamino]-3-phosphonopropyl]phosphonic acid;2-[2-(2-methylprop-2-enylperoxy)ethylcarbamoyloxy]ethyl 2,2-dimethylbutanoate |
| SMILES | C=C(C)COOCCNC(=O)OCCOC(=O)C(C)(C)CC.CCC(C)(C)C(=O)OCCNC(=O)NC(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C15H27NO6.C12H26N2O9P2/c1-6-15(4,5)13(17)19-9-10-20-14(18)16-7-8-21-22-11-12(2)3;1-4-12(2,3)10(15)23-6-5-13-11(16)14-9(7-24(17,18)19)8-25(20,21)22/h2,6-11H2,1,3-5H3,(H,16,18);9H,4-8H2,1-3H3,(H2,13,14,16)(H2,17,18,19)(H2,20,21,22) |
| InChIKey | HUAMFGNSGOZHRV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 265.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.67 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|