C37H41F3O6S3 — CID 165388758
[4-[ethyl-methyl-[4-(4-phenylbenzenecarbothioyl)phenyl]-λ4-sulfanyl]oxysulfonyl-3,4,4-trifluorobutyl] 3-hydroxyadamantane-1-carboxylate (PubChem CID 165388758) has the molecular formula C37H41F3O6S3 and a molecular weight of 734.92 g/mol. Its IUPAC name is [4-[ethyl-methyl-[4-(4-phenylbenzenecarbothioyl)phenyl]-λ4-sulfanyl]oxysulfonyl-3,4,4-trifluorobutyl] 3-hydroxyadamantane-1-carboxylate.
| Compound Name | [4-[ethyl-methyl-[4-(4-phenylbenzenecarbothioyl)phenyl]-λ4-sulfanyl]oxysulfonyl-3,4,4-trifluorobutyl] 3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 165388758 |
| Molecular Formula | C37H41F3O6S3 |
| Molecular Weight | 734.92 g/mol |
| Exact Mass | 734.20 |
| IUPAC Name | [4-[ethyl-methyl-[4-(4-phenylbenzenecarbothioyl)phenyl]-λ4-sulfanyl]oxysulfonyl-3,4,4-trifluorobutyl] 3-hydroxyadamantane-1-carboxylate |
| SMILES | CCS(C)(OS(=O)(=O)C(F)(F)C(F)CCOC(=O)C12CC3CC(CC(O)(C3)C1)C2)c1ccc(C(=S)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C37H41F3O6S3/c1-3-48(2,31-15-13-30(14-16-31)33(47)29-11-9-28(10-12-29)27-7-5-4-6-8-27)46-49(43,44)37(39,40)32(38)17-18-45-34(41)35-20-25-19-26(21-35)23-36(42,22-25)24-35/h4-16,25-26,32,42H,3,17-24H2,1-2H3 |
| InChIKey | QBZYQKIGPNDBQN-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.92 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|