C22H28O5 — CID 121308454
(2,3-dimethyl-5-oxo-2H-furan-4-yl) 3-(3-methyl-2-oxobut-3-enyl)adamantane-1-carboxylate (PubChem CID 121308454) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (2,3-dimethyl-5-oxo-2H-furan-4-yl) 3-(3-methyl-2-oxobut-3-enyl)adamantane-1-carboxylate.
| Compound Name | (2,3-dimethyl-5-oxo-2H-furan-4-yl) 3-(3-methyl-2-oxobut-3-enyl)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 121308454 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (2,3-dimethyl-5-oxo-2H-furan-4-yl) 3-(3-methyl-2-oxobut-3-enyl)adamantane-1-carboxylate |
| SMILES | C=C(C)C(=O)CC12CC3CC(C1)CC(C(=O)OC1=C(C)C(C)OC1=O)(C3)C2 |
| InChI | InChI=1S/C22H28O5/c1-12(2)17(23)10-21-6-15-5-16(7-21)9-22(8-15,11-21)20(25)27-18-13(3)14(4)26-19(18)24/h14-16H,1,5-11H2,2-4H3 |
| InChIKey | PKWBBNILJOLQEO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|