C12H17BrO2 — CID 6927330
(5R,7R)-3-(bromomethyl)adamantane-1-carboxylic acid (PubChem CID 6927330) has the molecular formula C12H17BrO2 and a molecular weight of 273.17 g/mol. Its IUPAC name is (5R,7R)-3-(bromomethyl)adamantane-1-carboxylic acid.
| Compound Name | (5R,7R)-3-(bromomethyl)adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 6927330 |
| Molecular Formula | C12H17BrO2 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | (5R,7R)-3-(bromomethyl)adamantane-1-carboxylic acid |
| SMILES | O=C(O)C12C[C@H]3C[C@@H](CC(CBr)(C3)C1)C2 |
| InChI | InChI=1S/C12H17BrO2/c13-7-11-2-8-1-9(3-11)5-12(4-8,6-11)10(14)15/h8-9H,1-7H2,(H,14,15)/t8-,9-,11?,12?/m0/s1 |
| InChIKey | SQQIKWVDOVKLTI-CRRMYELQSA-N |
| XLogP | 3.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|