C13H20O5S — CID 170309771
(5R,7S)-3-(methylsulfonyloxymethyl)adamantane-1-carboxylic acid (PubChem CID 170309771) has the molecular formula C13H20O5S and a molecular weight of 288.37 g/mol. Its IUPAC name is (5R,7S)-3-(methylsulfonyloxymethyl)adamantane-1-carboxylic acid.
| Compound Name | (5R,7S)-3-(methylsulfonyloxymethyl)adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 170309771 |
| Molecular Formula | C13H20O5S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (5R,7S)-3-(methylsulfonyloxymethyl)adamantane-1-carboxylic acid |
| SMILES | CS(=O)(=O)OCC12C[C@H]3C[C@@H](C1)CC(C(=O)O)(C3)C2 |
| InChI | InChI=1S/C13H20O5S/c1-19(16,17)18-8-12-3-9-2-10(4-12)6-13(5-9,7-12)11(14)15/h9-10H,2-8H2,1H3,(H,14,15)/t9-,10+,12?,13? |
| InChIKey | YJEZSNDEMKGSEA-ASZHBFLOSA-N |
| XLogP | 1.63 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|