C18H28N4O3S — CID 169229073
(2S)-N-[(2Z,4E,6Z)-5-(aminomethyl)-2-methoxy-7-(methylideneamino)-6-methylsulfanylocta-2,4,6-trienyl]-1-formylpyrrolidine-2-carboxamide (PubChem CID 169229073) has the molecular formula C18H28N4O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is (2S)-N-[(2Z,4E,6Z)-5-(aminomethyl)-2-methoxy-7-(methylideneamino)-6-methylsulfanylocta-2,4,6-trienyl]-1-formylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2Z,4E,6Z)-5-(aminomethyl)-2-methoxy-7-(methylideneamino)-6-methylsulfanylocta-2,4,6-trienyl]-1-formylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 169229073 |
| Molecular Formula | C18H28N4O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | (2S)-N-[(2Z,4E,6Z)-5-(aminomethyl)-2-methoxy-7-(methylideneamino)-6-methylsulfanylocta-2,4,6-trienyl]-1-formylpyrrolidine-2-carboxamide |
| SMILES | C=N/C(C)=C(SC)/C(=C/C=C(/CNC(=O)[C@@H]1CCCN1C=O)OC)CN |
| InChI | InChI=1S/C18H28N4O3S/c1-13(20-2)17(26-4)14(10-19)7-8-15(25-3)11-21-18(24)16-6-5-9-22(16)12-23/h7-8,12,16H,2,5-6,9-11,19H2,1,3-4H3,(H,21,24)/b14-7+,15-8-,17-13-/t16-/m0/s1 |
| InChIKey | GBBKMQJNCTVWOQ-XRRPUXQZSA-N |
| XLogP | 1.43 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|