C17H22N2O4 — CID 71545477
[(2S)-2-[[(2S)-1-formylpiperidine-2-carbonyl]amino]-2-phenylethyl] acetate (PubChem CID 71545477) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is [(2S)-2-[[(2S)-1-formylpiperidine-2-carbonyl]amino]-2-phenylethyl] acetate.
| Compound Name | [(2S)-2-[[(2S)-1-formylpiperidine-2-carbonyl]amino]-2-phenylethyl] acetate |
|---|---|
| PubChem CID | 71545477 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | [(2S)-2-[[(2S)-1-formylpiperidine-2-carbonyl]amino]-2-phenylethyl] acetate |
| SMILES | CC(=O)OC[C@@H](NC(=O)[C@@H]1CCCCN1C=O)c1ccccc1 |
| InChI | InChI=1S/C17H22N2O4/c1-13(21)23-11-15(14-7-3-2-4-8-14)18-17(22)16-9-5-6-10-19(16)12-20/h2-4,7-8,12,15-16H,5-6,9-11H2,1H3,(H,18,22)/t15-,16+/m1/s1 |
| InChIKey | TVMOFTQWTDYBBH-CVEARBPZSA-N |
| XLogP | 1.42 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|