C25H38N2O3 — CID 137373058
tert-butyl 4-[2-(cyclohexanecarbonylamino)-2-phenylethyl]piperidine-1-carboxylate (PubChem CID 137373058) has the molecular formula C25H38N2O3 and a molecular weight of 414.59 g/mol. Its IUPAC name is tert-butyl 4-[2-(cyclohexanecarbonylamino)-2-phenylethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(cyclohexanecarbonylamino)-2-phenylethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137373058 |
| Molecular Formula | C25H38N2O3 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | tert-butyl 4-[2-(cyclohexanecarbonylamino)-2-phenylethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC(NC(=O)C2CCCCC2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H38N2O3/c1-25(2,3)30-24(29)27-16-14-19(15-17-27)18-22(20-10-6-4-7-11-20)26-23(28)21-12-8-5-9-13-21/h4,6-7,10-11,19,21-22H,5,8-9,12-18H2,1-3H3,(H,26,28) |
| InChIKey | NFGFVNVJZRQMOX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |