C28H36N2O3 — CID 137373103
tert-butyl 4-[2-[(4-cyclopropylbenzoyl)amino]-2-phenylethyl]piperidine-1-carboxylate (PubChem CID 137373103) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is tert-butyl 4-[2-[(4-cyclopropylbenzoyl)amino]-2-phenylethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(4-cyclopropylbenzoyl)amino]-2-phenylethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137373103 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | tert-butyl 4-[2-[(4-cyclopropylbenzoyl)amino]-2-phenylethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC(NC(=O)c2ccc(C3CC3)cc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H36N2O3/c1-28(2,3)33-27(32)30-17-15-20(16-18-30)19-25(23-7-5-4-6-8-23)29-26(31)24-13-11-22(12-14-24)21-9-10-21/h4-8,11-14,20-21,25H,9-10,15-19H2,1-3H3,(H,29,31) |
| InChIKey | SDSRZGODTLRTEC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |