C27H36FN3O3 — CID 137373334
tert-butyl 4-[3-(benzylamino)-2-[(4-fluorobenzoyl)amino]propyl]piperidine-1-carboxylate (PubChem CID 137373334) has the molecular formula C27H36FN3O3 and a molecular weight of 469.60 g/mol. Its IUPAC name is tert-butyl 4-[3-(benzylamino)-2-[(4-fluorobenzoyl)amino]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(benzylamino)-2-[(4-fluorobenzoyl)amino]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137373334 |
| Molecular Formula | C27H36FN3O3 |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | tert-butyl 4-[3-(benzylamino)-2-[(4-fluorobenzoyl)amino]propyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC(CNCc2ccccc2)NC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H36FN3O3/c1-27(2,3)34-26(33)31-15-13-20(14-16-31)17-24(19-29-18-21-7-5-4-6-8-21)30-25(32)22-9-11-23(28)12-10-22/h4-12,20,24,29H,13-19H2,1-3H3,(H,30,32) |
| InChIKey | LZCWSIRWDMZWHU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |