C28H37FN2O4 — CID 137385223
tert-butyl 4-[(1R)-1-[(4-fluorobenzoyl)amino]-4-phenylmethoxybutyl]piperidine-1-carboxylate (PubChem CID 137385223) has the molecular formula C28H37FN2O4 and a molecular weight of 484.61 g/mol. Its IUPAC name is tert-butyl 4-[(1R)-1-[(4-fluorobenzoyl)amino]-4-phenylmethoxybutyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1R)-1-[(4-fluorobenzoyl)amino]-4-phenylmethoxybutyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137385223 |
| Molecular Formula | C28H37FN2O4 |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | tert-butyl 4-[(1R)-1-[(4-fluorobenzoyl)amino]-4-phenylmethoxybutyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC([C@@H](CCCOCc2ccccc2)NC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H37FN2O4/c1-28(2,3)35-27(33)31-17-15-22(16-18-31)25(30-26(32)23-11-13-24(29)14-12-23)10-7-19-34-20-21-8-5-4-6-9-21/h4-6,8-9,11-14,22,25H,7,10,15-20H2,1-3H3,(H,30,32)/t25-/m1/s1 |
| InChIKey | GOQLOHYVBUDEJW-RUZDIDTESA-N |
| XLogP | 5.57 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|