C25H30F2N2O4 — CID 137372955
(3-fluoro-2-methylphenyl) 4-[1-[(4-fluorobenzoyl)amino]-4-methoxybutyl]piperidine-1-carboxylate (PubChem CID 137372955) has the molecular formula C25H30F2N2O4 and a molecular weight of 460.52 g/mol. Its IUPAC name is (3-fluoro-2-methylphenyl) 4-[1-[(4-fluorobenzoyl)amino]-4-methoxybutyl]piperidine-1-carboxylate.
| Compound Name | (3-fluoro-2-methylphenyl) 4-[1-[(4-fluorobenzoyl)amino]-4-methoxybutyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137372955 |
| Molecular Formula | C25H30F2N2O4 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | (3-fluoro-2-methylphenyl) 4-[1-[(4-fluorobenzoyl)amino]-4-methoxybutyl]piperidine-1-carboxylate |
| SMILES | COCCCC(NC(=O)c1ccc(F)cc1)C1CCN(C(=O)Oc2cccc(F)c2C)CC1 |
| InChI | InChI=1S/C25H30F2N2O4/c1-17-21(27)5-3-7-23(17)33-25(31)29-14-12-18(13-15-29)22(6-4-16-32-2)28-24(30)19-8-10-20(26)11-9-19/h3,5,7-11,18,22H,4,6,12-16H2,1-2H3,(H,28,30) |
| InChIKey | BXBBURSJCJRQMT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|