About (2-methoxy-3-pyridinyl) 4-[1-[(4-chlorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate
(2-methoxy-3-pyridinyl) 4-[1-[(4-chlorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate (PubChem CID 137372714) has the molecular formula C24H30ClN3O4
and a molecular weight of 459.97 g/mol. Its IUPAC name is (2-methoxy-3-pyridinyl) 4-[1-[(4-chlorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (2-methoxy-3-pyridinyl) 4-[1-[(4-chlorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate |
| PubChem CID | 137372714 |
| Molecular Formula | C24H30ClN3O4 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | (2-methoxy-3-pyridinyl) 4-[1-[(4-chlorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate |
| SMILES | COc1ncccc1OC(=O)N1CCC(C(CC(C)C)NC(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H30ClN3O4/c1-16(2)15-20(27-22(29)18-6-8-19(25)9-7-18)17-10-13-28(14-11-17)24(30)32-21-5-4-12-26-23(21)31-3/h4-9,12,16-17,20H,10-11,13-15H2,1-3H3,(H,27,29) |
| InChIKey | RYCPSOHUQDFCEM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-methoxy-3-pyridinyl) 4-[1-[(4-chlorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-3-pyridinyl) 4-[1-[(4-chlorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate?
The IUPAC name of (2-methoxy-3-pyridinyl) 4-[1-[(4-chlorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate (CID 137372714) is (2-methoxy-3-pyridinyl) 4-[1-[(4-chlorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate.
What is the SMILES notation for (2-methoxy-3-pyridinyl) 4-[1-[(4-chlorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate?
The canonical SMILES for (2-methoxy-3-pyridinyl) 4-[1-[(4-chlorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate is COc1ncccc1OC(=O)N1CCC(C(CC(C)C)NC(=O)c2ccc(Cl)cc2)CC1.
What is the InChIKey of (2-methoxy-3-pyridinyl) 4-[1-[(4-chlorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate?
The InChIKey is RYCPSOHUQDFCEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30ClN3O4/c1-16(2)15-20(27-22(29)18-6-8-19(25)9-7-18)17-10-13-28(14-11-17)24(30)32-21-5-4-12-26-23(21)31-3/h4-9,12,16-17,20H,10-11,13-15H2,1-3H3,(H,27,29).
What are the key properties of (2-methoxy-3-pyridinyl) 4-[1-[(4-chlorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate?
(2-methoxy-3-pyridinyl) 4-[1-[(4-chlorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate has a molecular weight of 459.97 g/mol, XLogP of 4.80, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-3-pyridinyl) 4-[1-[(4-chlorobenzoyl)amino]-3-methylbutyl]piperidine-1-carboxylate is sourced from PubChem (CID 137372714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).