C20H20F2N2O3 — CID 170956165
N-[1-[4-(2,3-difluorophenyl)phenyl]-2-hydroxyethyl]-1-formylpyrrolidine-2-carboxamide (PubChem CID 170956165) has the molecular formula C20H20F2N2O3 and a molecular weight of 374.39 g/mol. Its IUPAC name is N-[1-[4-(2,3-difluorophenyl)phenyl]-2-hydroxyethyl]-1-formylpyrrolidine-2-carboxamide.
| Compound Name | N-[1-[4-(2,3-difluorophenyl)phenyl]-2-hydroxyethyl]-1-formylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170956165 |
| Molecular Formula | C20H20F2N2O3 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[1-[4-(2,3-difluorophenyl)phenyl]-2-hydroxyethyl]-1-formylpyrrolidine-2-carboxamide |
| SMILES | O=CN1CCCC1C(=O)NC(CO)c1ccc(-c2cccc(F)c2F)cc1 |
| InChI | InChI=1S/C20H20F2N2O3/c21-16-4-1-3-15(19(16)22)13-6-8-14(9-7-13)17(11-25)23-20(27)18-5-2-10-24(18)12-26/h1,3-4,6-9,12,17-18,25H,2,5,10-11H2,(H,23,27) |
| InChIKey | UKEUTJZDHOLJIU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|