C26H34F2N2O2 — CID 166535542
N-[1-[4-(2,6-difluorophenyl)phenyl]ethyl]-1-methylpyrrolidine-2-carboxamide;3,3-dimethylbutanal (PubChem CID 166535542) has the molecular formula C26H34F2N2O2 and a molecular weight of 444.57 g/mol. Its IUPAC name is N-[1-[4-(2,6-difluorophenyl)phenyl]ethyl]-1-methylpyrrolidine-2-carboxamide;3,3-dimethylbutanal.
| Compound Name | N-[1-[4-(2,6-difluorophenyl)phenyl]ethyl]-1-methylpyrrolidine-2-carboxamide;3,3-dimethylbutanal |
|---|---|
| PubChem CID | 166535542 |
| Molecular Formula | C26H34F2N2O2 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | N-[1-[4-(2,6-difluorophenyl)phenyl]ethyl]-1-methylpyrrolidine-2-carboxamide;3,3-dimethylbutanal |
| SMILES | CC(C)(C)CC=O.CC(NC(=O)C1CCCN1C)c1ccc(-c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C20H22F2N2O.C6H12O/c1-13(23-20(25)18-7-4-12-24(18)2)14-8-10-15(11-9-14)19-16(21)5-3-6-17(19)22;1-6(2,3)4-5-7/h3,5-6,8-11,13,18H,4,7,12H2,1-2H3,(H,23,25);5H,4H2,1-3H3 |
| InChIKey | LPHWICYBRHSZFH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|